Chemistry:KP-1461

From HandWiki
Revision as of 09:12, 8 February 2024 by imported>WikiG (change)
(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Short description: Chemical compound

{{Infobox drug | drug_name = | INN = | type = | IUPAC_name = | image = KP1461.svg | alt = | caption = | pronounce = | tradename = | Drugs.com = | MedlinePlus = | pregnancy_AU = | pregnancy_AU_comment = | pregnancy_US = | pregnancy_category= | routes_of_administration = | legal_AU = | legal_AU_comment = | legal_BR = | legal_BR_comment = | legal_CA = | legal_DE = | legal_NZ = | legal_UK = | legal_US = | legal_UN = | legal_status = Investigational | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion = | CAS_number = 815588-85-3 | class = Reverse transcriptase inhibitor | ATCvet = | ATC_prefix = | ATC_suffix = | PubChem = 51003457 | ChemSpiderID = 32702166 | DrugBank = 05644 | UNII = 3PEN569TJP | C=16|H=23|N=4|O=6 | smiles = CCCCCCCOC(=O)NC1=NCN(C(=O)N1)[C@H]2C[C@@H]([C@H](O2)CO)O | StdInChI=1S/C16H28N4O6/c1-2-3-4-5-6-7-25-16(24)19-14-17-10-20(15(23)18-14)13-8-11(22)12(9-21)26-13/h11-13,21-22H,2-10H2,1H3,(H2,17,18,19,23,24)/t11-,12+,13+/m0/s1 | StdInChIKey = SZWIAFVYPPMZML-YNEHKIRRSA-N

KP-161 is an experimental antiviral drug being studied for the treatment of HIV/AIDS.[1] It belongs to the class of nucleoside reverse transcriptase inhibitors.[citation needed]

KP-1461 is a prodrug of the active antiviral agent KP-1212.[2]

References

  1. "KP-1461". AIDSinfo. U.S. Department of Health and Human Services. https://aidsinfo.nih.gov/drugs/554/kp-1461/0/patient. 
  2. "KP-1461". DrugBank. Canadian Institutes of Health Research. https://www.drugbank.ca/drugs/DB05644.