View source for Chemistry:5-Ethoxy-DMT

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 458142861
| IUPAC_name = 2-(5-Ethoxy-1''H''-indol-3-yl)-''N'',''N''-dimethylethanamine
| image = 5-EtO-DMT Structure.svg
<!--Clinical data-->
| tradename =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 855245-09-9 
| PubChem =  57468316
| UNII = RXJ4TM3EX4
| IUPHAR_ligand =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID      = 26286732
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI          = 1S/C14H20N2O/c1-4-17-12-5-6-14-13(9-12)11(10-15-14)7-8-16(2)3/h5-6,9-10,15H,4,7-8H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey       = OSUDCFCSUHGWJF-UHFFFAOYSA-N

<!--Chemical data-->
| C=14 | H=20 | N=2 | O=1 
| smiles = CCOc(cc12)ccc1[nH]cc2CCN(C)C

'''5-Ethoxy-DMT''' ('''5-ethoxy-''N'',''N''-dimethyltryptamine''', '''5-EtO-DMT''', '''''O''-ethylbufotenine''') is a [[Chemistry:Tryptamine|tryptamine]] [[Chemistry:Chemical derivative|derivative]] which has been previously synthesized as a chemical intermediate, but has not been studied to determine its pharmacology.<ref>[http://www.erowid.org/library/books_online/tihkal/tihkal19.shtml TIHKAL #19]</ref>{{unreliable source?|date=March 2015}}

The widespread recreational use of ''N'',''N''-dialkylated 5-methoxytryptamine derivatives including [[Chemistry:5-MeO-DMT|5-MeO-DMT]], [[Chemistry:5-MeO-MiPT|5-MeO-MiPT]] and [[Chemistry:5-MeO-DiPT|5-MeO-DiPT]] has led to concern that the 5-ethoxy [[Chemistry:Homologous series|homologs]] of these drugs could emerge as novel [[Chemistry:Designer drug|designer drug]]s, and consequently 5-EtO-DMT and other derivatives including 5-EtO-DET, 5-EtO-DPT, 5-EtO-DiPT, 5-EtO-DALT, 5-EtO-MPT, 5-EtO-MiPT, 5-EtO-EiPT, 5-EtO-MET and 5-EtO-EPT have been synthesized as [[Chemistry:Analytical chemistry|analytical standards]] in order to facilitate future research into these compounds.<ref>{{cite journal | vauthors = Tearavarich R, Hahnvajanawong V, Dempster N, Daley PF, Cozzi NV, Brandt SD | title = Microwave-accelerated preparation and analytical characterization of 5-ethoxy-N,N-dialkyl-[α,α,β,β-H(4) ]- and [α,α,β,β-D(4) ]-tryptamines | journal = Drug Testing and Analysis | volume = 3 | issue = 9 | pages = 597–608 | date = September 2011 | pmid = 21960544 | doi = 10.1002/dta.223 }}</ref>

== See also ==
* [[Chemistry:5-Benzyloxytryptamine|5-Benzyloxytryptamine]]
* 5-EtO-AMT
* [[Chemistry:5-Ethyl-DMT|5-Ethyl-DMT]]
* [[Chemistry:5-(Nonyloxy)tryptamine|5-(Nonyloxy)tryptamine]]
* [[Chemistry:O-Acetylbufotenine|O-Acetylbufotenine]]

== References ==
{{Reflist}}

{{Tryptamines}}

[[Category:Tryptamines]]
[[Category:Dimethylamino compounds]]
[[Category:Ethoxy compounds]]


{{Sourceattribution|5-Ethoxy-DMT}}