View source for Chemistry:AUTEN-67

{{Short description|Chemical compound}}
{{Infobox drug
| IUPAC_name        = ''N''-[3-(1H-Benzimidazol-1-yl)-1,4-dioxo-1,4-dihydro-2-naphthalenyl]-4-nitrobenzenesulfonamide<ref name="MyUser_Ncbi.nlm.nih.gov_May_5_2016c" />
| image             = AUTEN-67 skeletal.svg
| alt               = 
| caption           = 
<!-- Clinical data -->
| pronounce         = 
| tradename         = 
| Drugs.com         = 
| MedlinePlus       = 
| pregnancy_AU      = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment = 
| pregnancy_US      = <!-- A/B/C/D/X/N -->
| pregnancy_category= 
| routes_of_administration = 
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_DE = <!-- Anlage I, II, III -->
| legal_NZ = <!-- Class A, B, C -->
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_US = <!-- OTC/Rx-only/Schedule I, II, III, IV, V -->
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_status      = Investigational
<!-- Pharmacokinetic data -->
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| metabolites       =
| onset             = 
| elimination_half-life = 
| duration_of_action =
| excretion         = 
<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 301154-74-5
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = G53CH4RJ72
| ATCvet            = 
| ATC_prefix        = None
| ATC_suffix        = 
| PubChem           = 2324086
| DrugBank          = 
| ChemSpiderID      = 1736536
<!-- Chemical data -->
| chemical_formula  = 
| C=23 | H=14 | N=4 | O=6 | S=1
| molecular_weight  = 
| smiles = c1ccc2c(c1)C(=O)C(=C(C2=O)n3cnc4c3cccc4)NS(=O)(=O)c5ccc(cc5)[N+](=O)[O-]
| StdInChI=1S/C23H14N4O6S/c28-22-16-5-1-2-6-17(16)23(29)21(26-13-24-18-7-3-4-8-19(18)26)20(22)25-34(32,33)15-11-9-14(10-12-15)27(30)31/h1-13,25H
| StdInChIKey = FSAINSJUQREKEK-UHFFFAOYSA-N
}}
'''AUTEN-67''' is an [[Biology:Autophagy|autophagy]]-enhancing drug candidate that increases autophagic flux in cell lines and ''[[Biology:In vivo|in vivo]]'' models.<ref name="MyUser_Ncbi.nlm.nih.gov_May_5_2016c">{{cite journal | vauthors = Papp D, Kovács T, Billes V, Varga M, Tarnóci A, Hackler L, Puskás LG, Liliom H, Tárnok K, Schlett K, Borsy A, Pádár Z, Kovács AL, Hegedűs K, Juhász G, Komlós M, Erdős A, Gulyás B, Vellai T | display-authors = 6 | title = AUTEN-67, an autophagy-enhancing drug candidate with potent antiaging and neuroprotective effects | journal = Autophagy | volume = 12 | issue = 2 | pages = 273–86 | year = 2016 | pmid = 26312549 | pmc = 4835959 | doi = 10.1080/15548627.2015.1082023 }}</ref>

It hampers the progression of neurodegenerative symptoms in a ''[[Biology:Drosophila|Drosophila]]'' model of [[Medicine:Huntington's disease|Huntington's disease]].<ref>{{cite journal | vauthors = Billes V, Kovács T, Hotzi B, Manzéger A, Tagscherer K, Komlós M, Tarnóci A, Pádár Z, Erdős A, Bjelik A, Legradi A, Gulya K, Gulyás B, Vellai T | display-authors = 6 | title = AUTEN-67 (Autophagy Enhancer-67) Hampers the Progression of Neurodegenerative Symptoms in a Drosophila model of Huntington's Disease | journal = Journal of Huntington's Disease | volume = 5 | issue = 2 | pages = 133–47 | date = May 2016 | pmid = 27163946 | doi = 10.3233/JHD-150180 | url = http://content.iospress.com/articles/journal-of-huntingtons-disease/jhd150180 }}</ref>
It is developed by Velgene Biotechnology Ltd.

== References ==
{{reflist}}

[[Category:Sulfonamides]]
[[Category:Experimental drugs]]


{{Sourceattribution|AUTEN-67}}