View source for Chemistry:Bay K8644

{{Chembox
| Verifiedfields = changed
| Watchedfields  = changed
| verifiedrevid  = 422899306
| Reference      = <ref>[http://www.sigmaaldrich.com/catalog/ProductDetail.do?N4=B112|SIGMA&N5=SEARCH_CONCAT_PNO|BRAND_KEY&F=SPEC (±)-Bay K8644] at [[Company:Sigma-Aldrich|Sigma-Aldrich]]</ref>
| ImageFile      = Bay K8644 structure.svg
| ImageSize      = 180px
| ImageAlt       = Skeletal formula of Bay K8644
| ImageFile1     = Bay-K8644-3D-spacefill.png
| ImageSize1     = 180px
| ImageAlt1      = Space-filling model of the bay K8644 molecule
| PIN            = Methyl 2,6-dimethyl-5-nitro-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyridine-3-carboxylate
| OtherNames     = 
| Section1       = {{Chembox Identifiers
| IUPHAR_ligand = 2511
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 71145-03-4
| PubChem = 2303
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1082832
| SMILES = CC1=C(C(C(=C(N1)C)[N+](=O)[O-])C2=CC=CC=C2C(F)(F)F)C(=O)OC
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 2213
| ChEBI_Ref = {{ebicite|changed|EBI}} 
| ChEBI = 34555
| EINECS = 636-102-2
| InChI = 1/C16H15F3N2O4/c1-8-12(15(22)25-3)13(14(21(23)24)9(2)20-8)10-6-4-5-7-11(10)16(17,18)19/h4-7,13,20H,1-3H3
| InChIKey = ZFLWDHHVRRZMEI-UHFFFAOYAV
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H15F3N2O4/c1-8-12(15(22)25-3)13(14(21(23)24)9(2)20-8)10-6-4-5-7-11(10)16(17,18)19/h4-7,13,20H,1-3H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = ZFLWDHHVRRZMEI-UHFFFAOYSA-N
}}
| Section2       = {{Chembox Properties
| C=16 | H=15 | F=3 | N=2 | O=4
| Appearance = 
| Density = 
| MeltingPt = 
| BoilingPt = 
| Solubility = Insoluble
| SolubleOther = [[Chemistry:Dimethyl sulfoxide|DMSO]]: 184 mg/mL; [[Chemistry:Methanol|methanol]] and [[Chemistry:Ethanol|ethanol]]: 63 mg/mL
| Solvent = other solvents
}}
| Section3       = {{Chembox Hazards
| MainHazards = 
| GHSPictograms = {{GHS07}}
| GHSSignalWord = Warning
| HPhrases = {{H-phrases|315|319}}
| PPhrases = {{P-phrases|264|280|302+352|305+351+338|321|332+313|337+313|362}}
| FlashPt = 
| AutoignitionPt = 
}}
}}

'''Bay K8644''' is a [[Chemistry:Chemical compound|chemical compound]] that functions as an [[Biology:L-type calcium channel|L-type]] [[Biology:Calcium channel|calcium channel]] [[Biology:Agonist|agonist]]. Bay K8644 is used primarily as a biochemical research tool for this effect.<ref>{{PubChem|2303}}</ref> It is a structural analog of [[Chemistry:Nifedipine|nifedipine]] with positive inotropic activity, and  as an aromatic it is highly lipid soluble.

==Mechanism of action==
Bay K8644 targets [[Biology:L-type calcium channel|L-type]] [[Biology:Voltage-gated calcium channel|voltage-gated]] [[Biology:Calcium channel|calcium channels]]. It is the first positive inotropic agent shown to act specifically and directly on calcium channels.<ref>{{cite journal |last=Thomas  |first=G |last2=Chung  |first2=M |last3=Cohen |first3=CJ |date=January 1985 |title=A dihydropyridine (Bay k 8644) that enhances calcium currents in guinea pig and calf myocardial cells. A new type of positive inotropic agent. |pmid=2578336 |journal=Circ Res |volume= 56|issue= 1|pages= 87–96|doi= 10.1161/01.res.56.1.87|doi-access=free }}</ref>

==References==
{{Reflist}}

{{Channelergics}}

[[Category:Dihydropyridines]]
[[Category:Trifluoromethyl compounds]]
[[Category:Methyl esters]]
[[Category:Nitro compounds]]



{{Sourceattribution|Bay K8644}}