View source for Chemistry:Dieticyclidine

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 424837616
| IUPAC_name = N,N-diethyl-1-phenylcyclohexan-1-amine
| image = Dieticyclidine.svg
| width =

<!--Clinical data-->
| tradename =  
| pregnancy_category =  
| legal_CA = Schedule I
| legal_UK = Class B
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 2201-19-6
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8JY6P22UVD
| ATC_prefix = none
|  PubChem = 604690
|  ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 525655
|  smiles = CCN(CC)C1(CCCCC1)C2=CC=CC=C2
|  StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H25N/c1-3-17(4-2)16(13-9-6-10-14-16)15-11-7-5-8-12-15/h5,7-8,11-12H,3-4,6,9-10,13-14H2,1-2H3
|  StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GRHWLIMQOFAGHA-UHFFFAOYSA-N

<!--Chemical data-->
| C=16 | H=25 | N=1 
}}

'''Dieticyclidine''' ('''PCDE'''), or '''diethylphenylcyclohexylamine''', is a psychoactive drug and [[Chemistry:Research chemical|research chemical]] of the [[Chemistry:Arylcyclohexylamine|arylcyclohexylamine]] [[Chemistry:Chemical class|chemical class]] related to [[Chemistry:Phencyclidine|phencyclidine]] (PCP) and [[Chemistry:Eticyclidine|eticyclidine]] (PCE). It [[Chemistry:Drug action|act]]s as an [[Chemistry:NMDA receptor antagonist|NMDA receptor antagonist]] but has low potency and acts mainly as a [[Chemistry:Prodrug|prodrug]] for [[Chemistry:Eticyclidine|eticyclidine]].<ref name="pmid8095205">{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Landaw EM, Chang AS, Ramamurthy S, Jenden DJ | title = A pharmacokinetic study of phenylcyclohexyldiethylamine. An analog of phencyclidine | journal = Drug Metabolism and Disposition | volume = 21 | issue = 1 | pages = 125–32 | year = 1993 | pmid = 8095205 }}</ref><ref name="pmid8450474">{{cite journal | vauthors = Cho AK, Hiramatsu M, Schmitz DA, Vargas HM, Landaw EM | title = A behavioral and pharmacokinetic study of the actions of phenylcyclohexyldiethylamine and its active metabolite, phenylcyclohexylethylamine | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 264 | issue = 3 | pages = 1401–5 | date = March 1993 | pmid = 8450474 }}</ref>

== References ==
{{Reflist}}

{{General anesthetics}}
{{Hallucinogens}}
{{Dopamine receptor modulators}}
{{Ionotropic glutamate receptor modulators}}

[[Category:Diethylamino compounds]]
[[Category:Designer drugs]]
[[Category:NMDA receptor antagonists]]


{{Sourceattribution|Dieticyclidine}}