View source for Chemistry:Dihydrotestosterone acetate

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = 
| Watchedfields = 
| verifiedrevid = 
| IUPAC_name = [(5''S'',8''R'',9''S'',10''S'',13''S'',14''S'',17''S'')-10,13-dimethyl-3-oxo-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[''a'']phenanthren-17-yl] acetate
| image = Dihydrotestosterone acetate.svg
| width = 225px
| image2 = Dihydrotestosterone acetate molecule ball.png
| width2 = 225px

<!--Clinical data-->
| tradename = 
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = 
| legal_UK = 
| legal_US = 
| legal_status = 
| routes_of_administration = [[Biology:Intramuscular injection|Intramuscular injection]]

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!--Identifiers-->
| CAS_number_Ref = 
| CAS_number = 1164-91-6
| CAS_supplemental = 
| ATC_prefix = 
| ATC_suffix = 
| PubChem = 11809740
| DrugBank_Ref = 
| DrugBank = DB13951
| ChemSpiderID_Ref = 
| ChemSpiderID = 9984405
| UNII = 63Z2Y83W8N
| ChEMBL = 3275971
| synonyms = androstanolone acetate; Stanolone acetate; 5α-Dihydrotestosterone 17β-acetate; 17β-(Acetyloxy)-5α-androstan-3-one

<!--Chemical data-->
| C=21 | H=32 | O=3
| SMILES = CC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(CCC(=O)C4)C)C
| StdInChI_Ref = 
| StdInChI = 1S/C21H32O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h14,16-19H,4-12H2,1-3H3/t14-,16-,17-,18-,19-,20-,21-/m0/s1
| StdInChIKey_Ref = 
| StdInChIKey = ILCTUFVQFCIIDS-NGFSFWIMSA-N
}}

'''Dihydrotestosterone acetate''', also known as '''androstanolone acetate''' or '''stanolone acetate''', as well as '''5α-dihydrotestosterone 17β-acetate''',<ref name="YalkowskyHe2016">{{cite book| vauthors = Yalkowsky SH, He Y, Jain P |title=Handbook of Aqueous Solubility Data, Second Edition|url=https://books.google.com/books?id=cfFzJFthLCIC&pg=PA1260|date=19 April 2016|publisher=CRC Press|isbn=978-1-4398-0246-5|page=1260}}</ref> is a synthetic [[Biology:Androgen|androgen]] and [[Chemistry:Anabolic steroid|anabolic steroid]] and a dihydrotestosterone ester that was never marketed.<ref name="Elks2014">{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA640|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=640–}}</ref><ref name="MortonHall2012">{{cite book| vauthors = Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA261|date=6 December 2012|publisher=Springer Science & Business Media|isbn=978-94-011-4439-1|pages=261–}}</ref>

==See also==
* [[Chemistry:List of androgen esters#Dihydrotestosterone esters|List of androgen esters § Dihydrotestosterone esters]]

==References==
{{Reflist}}


{{Androgen receptor modulators}}

[[Category:Abandoned drugs]]
[[Category:Acetate esters]]
[[Category:Androstanes]]
[[Category:Dihydrotestosterone esters]]

{{Sourceattribution|Dihydrotestosterone acetate}}