View source for Chemistry:Normethadone

{{Short description|Synthetic opioid}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 462263227
| IUPAC_name = 6-dimethylamino-4,4-diphenyl-hexan-3-one
| image = Normethadone.png

<!--Clinical data-->
| tradename =  Cophylac
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = S9
| legal_BR = A1
| legal_CA = Schedule I
| legal_DE = Anlage III
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = Schedule I
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability = 100% 
| protein_bound =  
| metabolism = liver 
| elimination_half-life =  14 days
| excretion = Urine

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 467-85-6
| CAS_supplemental = <br />847-84-7 ([[Chemistry:Hydrochloride|HCl]])
| ATC_prefix = R05
| ATC_suffix = DA06
| PubChem = 10090
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9687
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = KR2L2A68XL
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07384
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 346331

<!--Chemical data-->
| C=20 | H=25 | N=1 | O=1 
| smiles = O=C(C(c1ccccc1)(c2ccccc2)CCN(C)C)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H25NO/c1-4-19(22)20(15-16-21(2)3,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,4,15-16H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WCJFBSYALHQBSK-UHFFFAOYSA-N
}}
'''Normethadone''' (INN, [[Chemistry:British Approved Name|BAN]]; brand names '''Ticarda''',  '''Cophylac''', '''Dacartil''', '''Eucopon''', '''Mepidon''', '''Noramidone''', '''Normedon''', and others), also known as '''desmethylmethadone''' or '''phenyldimazone''', is a [[Chemistry:Chemical synthesis|synthetic]] [[Chemistry:Opioid|opioid]] [[Biology:Analgesic|analgesic]] and antitussive agent.{{citation needed|date=September 2015}}
Normethadone is listed under the Single Convention on Narcotic Drugs 1961 and is a Schedule I Narcotic controlled substance in the United States, with a DEA ACSCN of 9635 and an annual manufacturing quota of 2 grams. It has an effective span of action for about 14 days, and is 12 to 20 times stronger than morphine. <ref>{{cite web | title = Quotas - 2014 | url = http://www.deadiversion.usdoj.gov/fed_regs/quotas/2014/fr0825.htm | publisher = U.S. Department of Justice, Drug Enforcement Administration | work = Diversion Control Division | access-date = 2016-02-27 | archive-date = 2016-03-04 | archive-url = https://web.archive.org/web/20160304053357/http://www.deadiversion.usdoj.gov/fed_regs/quotas/2014/fr0825.htm | url-status = dead }}</ref>  The salts in use are the hydrobromide (free base conversion ratio 0.785), hydrochloride (0.890), methyliodide (0.675), oxalate (0.766), picrate (0.563), and the 2,6-ditertbutylnapthalindisulphonate (0.480).<ref>{{cite book | vauthors = Nordegren T | chapter = Normethadone | chapter-url = https://books.google.com/books?id=4yaGePenGKgC&q=Normethadone&pg=PA469 |title=The A-Z encyclopedia of alcohol and drug abuse |date=2002 |publisher=Brown Walker Press |location=Parkland, Fla. |isbn=978-1-58112-404-0 | page = 470 }}</ref>

==See also==
* [[Chemistry:Methade|Methade]]

==References==
{{Reflist|2}}

{{Analgesics}}
{{Cough and cold preparations}}
{{Opioidergics}}

[[Category:Dimethylamino compounds]]
[[Category:Analgesics]]
[[Category:Antitussives]]
[[Category:Ketones]]
[[Category:Mu-opioid receptor agonists]]
[[Category:Synthetic opioids]]



{{Sourceattribution|Normethadone}}