View source for Chemistry:PF-219,061

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 451228063
| IUPAC_name = (''R'')-3-(4-propylmorpholin-2-yl)phenol
| image = PF-219,061 Structural Formulae.png
| width = 200

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4  / S8 -->
| legal_UK = <!-- GSL         / P       / POM / CD -->
| legal_US = <!-- OTC                   / Rx-only  -->
| legal_status =  Investigational (discontinued)
| routes_of_administration = Nasal

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 710654-74-3
| ATC_prefix =  
| ATC_suffix =  
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZK5ZP8L5S2
| PubChem = 9794475
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID      = 7970242

<!--Chemical data-->
| C=13 | H=19 | N=1 | O=2 
| smiles = CCCN1CCO[C@@H](C1)C2=CC(=CC=C2)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI          = 1S/C13H19NO2/c1-2-6-14-7-8-16-13(10-14)11-4-3-5-12(15)9-11/h3-5,9,13,15H,2,6-8,10H2,1H3/t13-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey       = WYEGTIGJSHGEID-ZDUSSCGKSA-N
}}

'''PF-219,061''' is a drug that was under [[Medicine:Drug development|development]] by [[Company:Pfizer|Pfizer]] which acts as a potent and highly [[Biology:Functional selectivity|selective]] [[Biology:Agonist|agonist]] for the [[Biology:Dopamine|dopamine]] D<sub>3</sub> [[Biology:Receptor (biochemistry)|receptor]].<ref>{{cite journal | vauthors = Blagg J, Allerton CM, Batchelor DV, Baxter AD, Burring DJ, Carr CL, Cook AS, Nichols CL, Phipps J, Sanderson VG, Verrier H, Wong S | display-authors = 6 | title = Design and synthesis of a functionally selective D3 agonist and its in vivo delivery via the intranasal route | journal = Bioorganic & Medicinal Chemistry Letters | volume = 17 | issue = 24 | pages = 6691–6 | date = December 2007 | pmid = 17976986 | doi = 10.1016/j.bmcl.2007.10.059 }}</ref><ref>{{cite journal | doi = 10.1016/j.ddstr.2006.10.006| title = Dopamine D4 receptors and the regulation of penile erection| journal = Drug Discovery Today: Therapeutic Strategies| volume = 3| issue = 4| pages = 599–604| year = 2006| vauthors = Brioni JD, Moreland RB }}</ref> It was under development as a potential medication for the treatment of female sexual dysfunction.<ref>[http://www.wipo.int/pctdb/en/wo.jsp?IA=GB2002005595&DISPLAY=STATUS Van Der Graaf et al. Selective Dopamine D3 Receptor Agonists for the Treatment of Sexual Dysfunction, WIPO Patent WO/2003/051370, granted to Pfizer]{{Dead link|date=April 2020 |bot=InternetArchiveBot |fix-attempted=yes }}</ref><ref>{{cite journal | vauthors = Attkins NJ, Heatherington AC, Phipps J, Verrier H, Huyghe I | title = Predictability of intranasal pharmacokinetics in man using pre-clinical pharmacokinetic data with a dopamine 3 receptor agonist, PF-219061 | journal = Xenobiotica; the Fate of Foreign Compounds in Biological Systems | volume = 39 | issue = 7 | pages = 523–33 | date = July 2009 | pmid = 19480558 | doi = 10.1080/00498250902893775 | s2cid = 26474660 }}</ref>  It did not advance into clinical trials.<ref>{{cite journal | vauthors = Cortés A, Moreno E, Rodríguez-Ruiz M, Canela EI, Casadó V | title = Targeting the dopamine D3 receptor: an overview of drug design strategies | journal = Expert Opinion on Drug Discovery | volume = 11 | issue = 7 | pages = 641–64 | date = July 2016 | pmid = 27135354 | doi = 10.1080/17460441.2016.1185413 | s2cid = 205917989 }}</ref>

== See also ==
* [[Chemistry:ABT-670|ABT-670]]
* [[Chemistry:ABT-724|ABT-724]]
* [[Chemistry:Cabergoline|Cabergoline]]
* [[Chemistry:Bremelanotide|Bremelanotide]]
* [[Chemistry:Flibanserin|Flibanserin]]
* Intrinsa
* [[Chemistry:Melanotan II|Melanotan II]]
* [[Chemistry:OSU-6162|OSU-6162]]
* [[Chemistry:PF-592,379|PF-592,379]]
* [[Chemistry:Pramipexole|Pramipexole]]
* [[Chemistry:Tibolone|Tibolone]]
* [[Chemistry:UK-414,495|UK-414,495]]

== References ==
{{reflist}}

{{Dopaminergics}}

[[Category:Dopamine agonists]]
[[Category:Phenylmorpholines]]
[[Category:Phenols]]
[[Category:Abandoned drugs]]

{{Sourceattribution|PF-219,061}}