View source for Chemistry:Quinupristin

{{Drugbox
| IUPAC_name        = ''N''-<nowiki/>{(6''R'',9''S'',10''R'',13''S'',15a''S'',18''R'',22''S'',24a''S'')-18-
{[(3''S'')-1-azabicyclo[2.2.2]oct-3-ylthio]methyl}-22-[4-(dimethylamino)benzyl]-
6-ethyl-10,23-dimethyl-5,8,12,15,17,21,24-heptaoxo-13-phenyldocosahydro-12''H''-
pyrido[2,1-''f'']pyrrolo-[2,1-''l''][1,4,7,10,13,16] oxapentaazacyclononadecin-9-yl}-3-
hydroxypyridine-2-carboxamide
| image             = Quinupristin.png
| CAS_number        = 120138-50-3
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 23OW28RS7P
| ATC_prefix        = 
| ATC_suffix        = 
| PubChem           = 5388937
| DrugBank          = 
| ChEMBL            = 1200649
| ChemSpiderID      = 4470884
| smiles            = CC[C@@H]1C(=O)N2CCC[C@H]2C(=O)N([C@H](C(=O)N3C[C@H](C(=O)C[C@H]3C(=O)N[C@H](C(=O)O[C@@H]([C@@H](C(=O)N1)NC(=O)C4=C(C=CC=N4)O)C)C5=CC=CC=C5)CS[C@@H]6CN7CCC6CC7)CC8=CC=C(C=C8)N(C)C)C
| StdInChI          = 1S/C53H67N9O10S/c1-6-37-50(68)61-23-11-14-38(61)51(69)59(5)40(26-32-16-18-36(19-17-32)58(3)4)52(70)62-28-35(30-73-43-29-60-24-20-33(43)21-25-60)42(64)27-39(62)47(65)57-45(34-12-8-7-9-13-34)53(71)72-31(2)44(48(66)55-37)56-49(67)46-41(63)15-10-22-54-46/h7-10,12-13,15-19,22,31,33,35,37-40,43-45,63H,6,11,14,20-21,23-30H2,1-5H3,(H,55,66)(H,56,67)(H,57,65)/t31-,35+,37-,38+,39+,40+,43-,44+,45+/m1/s1
| StdInChIKey       = WTHRRGMBUAHGNI-LCYNINFDSA-N
| C=53|H=67|N=9|O=10|S=1
| bioavailability   = 
| protein_bound     = 
| metabolism        = 
| elimination_half-life = 3.1 hours
| excretion         = 
| pregnancy_AU      =  <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US      =  <!-- A / B            / C / D / X -->
| pregnancy_category=  
| legal_AU =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status      = 
| routes_of_administration = 
}}

'''Quinupristin''' is a [[Chemistry:Streptogramin B|streptogramin B]] [[Chemistry:Antibiotic|antibiotic]], used in combination with [[Chemistry:Dalfopristin|dalfopristin]] under the trade name Synercid. It has activity against [[Biology:Gram-positive bacteria|Gram-positive]] and [[Biology:Atypical bacteria|atypical bacteria]] but not [[Biology:Gram-negative bacteria|Gram-negative bacteria]]. It inhibits bacterial protein synthesis. The combination of quinupristin and dalfopristin is not active against ''[[Biology:Enterococcus faecalis|Enterococcus faecalis]]'' and needs to be given in combination with other antibacterials for mixed infections that involve Gram-negative organisms.
[[Category:Antibiotics]]

{{Unreferenced|date=2021}}
{{Sourceattribution|Quinupristin}}