View source for Chemistry:Solvent Violet 13

{{Chembox
| Verifiedimages = changed
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 444114255
| ImageFile_Ref = {{chemboximage|correct|??}}
| ImageFile = Solvent Violet 13.png
| ImageSize = 
| PIN = 1-Hydroxy-4-(4-methylanilino)anthracene-9,10-dione
| OtherNames = 
|Section1={{Chembox Identifiers
| InChI = 1/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3
| InChIKey = LJFWQNJLLOFIJK-UHFFFAOYAI
| InChI1 = 1S/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3
| InChIKey1 = LJFWQNJLLOFIJK-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 81-48-1

| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 350KA7O6HK


| PubChem = 6680
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6428
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = LJFWQNJLLOFIJK-UHFFFAOYSA-N
| SMILES = O=C2c1ccccc1C(=O)c3c2c(ccc3O)Nc4ccc(cc4)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =1S/C21H15NO3/c1-12-6-8-13(9-7-12)22-16-10-11-17(23)19-18(16)20(24)14-4-2-3-5-15(14)21(19)25/h2-11,22-23H,1H3
  }}
|Section2={{Chembox Properties
| C=21 | H=15 | N=1 | O=3
| Appearance = 
| Density = 
| MeltingPtC = 142 to 143
| MeltingPt_notes = 
| BoilingPt = 
| Solubility =
  }}
|Section3={{Chembox Hazards
| MainHazards = 
| FlashPt = 
| AutoignitionPt = 
 }}
}}
'''Solvent Violet 13''', also known as '''D&amp;C Violet No.2''', '''oil violet''', '''Solvent Blue 90''', '''Alizarine Violet 3B''', '''Alizurol Purple''', '''Duranol Brilliant Violet TG''', '''Ahcoquinone Blue IR base''', '''Quinizarin Blue''', '''Disperse Blue 72''', and '''C.I. 60725''', is a synthetic anthraquinone dye with bright bluish violet hue. It is a solid insoluble in water and soluble in [[Chemistry:Acetone|acetone]], [[Chemistry:Toluene|toluene]], and [[Chemistry:Benzene|benzene]]. Its chemical formula is C<sub>21</sub>H<sub>15</sub>NO<sub>3</sub>, and its structure is 1-hydroxy-4-(''p''-tolylamino)anthraquinone, or 1-hydroxy-4-[(4-methylphenyl)amino]-9,10-anthracenedione or 1-hydroxy-4-(4-methylanilino)anthraquinone.

Solvent Violet 13 is used to dye [[Chemistry:Hydrocarbon|hydrocarbon]] products like [[Physics:Solvent|solvent]]s and petrol, [[Chemistry:Thermoplastic|thermoplastic]]s, synthetic resins, e.g. [[Chemistry:Polystyrene|polystyrene]]s, and [[Engineering:Synthetic fiber|synthetic fiber]]. It is also used in cosmetics, e.g. in hair and skin care products. In [[Pyrotechnics|pyrotechnics]], it is used in some violet colored smoke compositions.<ref>Hans-Samuel Bien, Josef Stawitz, Klaus Wunderlich "Anthraquinone Dyes and Intermediates" Ullmann's Encyclopedia of Industrial Chemistry 2002 Wiley-VCH, Weinhem.  {{doi|10.1002/14356007.a02_355}}</ref>

==References==
<references/>

[[Category:Solvent dyes]]
[[Category:Anilines]]

{{Sourceattribution|Solvent Violet 13}}