View source for Chemistry:UK-414,495

{{short description|Female sexual arousal disorder medication}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451558838
| IUPAC_name = (2''R'')-2-({1-[(5-ethyl-1,3,4-thiadiazol-2-yl)carbamoyl]cyclopentyl}methyl)pentanoic acid
| image = UK-414,495.svg
| width =

<!--Clinical data-->
| tradename =
| licence_EU =
| pregnancy_category =
| legal_UK =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 337962-93-3
| ATC_suffix =
| PubChem = 9949799
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 378763
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JV29CG9MQ2
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8125410

<!--Chemical data-->
| C=16 | H=25 | N=3 | O=3 | S=1
| smiles = CCC[C@H](CC1(CCCC1)C(=O)NC2=NN=C(S2)CC)C(=O)O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H25N3O3S/c1-3-7-11(13(20)21)10-16(8-5-6-9-16)14(22)17-15-19-18-12(4-2)23-15/h11H,3-10H2,1-2H3,(H,20,21)(H,17,19,22)/t11-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = FWXXCSISWQQOGS-LLVKDONJSA-N
}}

'''UK-414,495''' is a drug developed by [[Company:Pfizer|Pfizer]] for the treatment of [[Medicine:Female sexual arousal disorder|female sexual arousal disorder]]. UK-414,495 acts as a potent, selective inhibitor of the enzyme neutral endopeptidase, which normally serves to break down the [[Biology:Neuropeptide|neuropeptide]] [[Biology:Vasoactive intestinal peptide|VIP]]. The consequent increase in VIP activity alters blood flow to the genital region leading to increased lubrication and muscle relaxation.<ref name="pmid16550257">{{cite journal | vauthors = Armer R, Warne P, Witherington J | title = Recent disclosures of clinical drug candidates | journal = Drug News & Perspectives | volume = 19 | issue = 1 | pages = 65–72 | year = 2006 | pmid = 16550257 }}</ref><ref>{{cite journal | vauthors = Angulo J | title = Neutral endopeptidase inhibition: could it have a role in the treatment of female sexual arousal disorder? | journal = British Journal of Pharmacology | volume = 160 | issue = 1 | pages = 48–50 | date = May 2010 | pmid = 20412067 | pmc = 2860205 | doi = 10.1111/j.1476-5381.2010.00693.x }}</ref><ref>{{cite journal | vauthors = Wayman CP, Baxter D, Turner L, Van Der Graaf PH, Naylor AM | title = UK-414,495, a selective inhibitor of neutral endopeptidase, potentiates pelvic nerve-stimulated increases in female genital blood flow in the anaesthetized rabbit | journal = British Journal of Pharmacology | volume = 160 | issue = 1 | pages = 51–59 | date = May 2010 | pmid = 20412068 | pmc = 2860206 | doi = 10.1111/j.1476-5381.2010.00691.x }}</ref>

== See also ==
* [[Chemistry:ABT-670|ABT-670]]
* [[Chemistry:ABT-724|ABT-724]]
* [[Chemistry:Bremelanotide|Bremelanotide]]
* [[Chemistry:Cabergoline|Cabergoline]]
* [[Chemistry:Flibanserin|Flibanserin]]
* [[Chemistry:Testosterone (patch)|Testosterone (patch)]]
* [[Chemistry:Melanotan II|Melanotan II]]
* [[Chemistry:Pramipexole|Pramipexole]]
* [[Chemistry:PF-219,061|PF-219,061]]
* [[Chemistry:S-17092|S-17092]]
* [[Chemistry:Tibolone|Tibolone]]

== References ==
{{Reflist}}

[[Category:Hydrolase inhibitors]]
[[Category:Thiadiazoles]]
[[Category:Carboxamides]]
[[Category:Carboxylic acids]]
[[Category:Cyclopentanes]]


{{Sourceattribution|UK-414,495}}