View source for Chemistry:Peruvoside

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 464199541
| IUPAC_name = (3β,5β,8ξ,9ξ)- 3-[(6-deoxy- 3-''O''-methyl- α-<small>D</small>- ''glycero''- hexopyranosyl)oxy]- 14-hydroxy- 19-oxocard- 20(22)enolide
| image = Peruvoside.svg

<!--Clinical data-->
| tradename =  
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 1182-87-2
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = CT36KGC6A6
| ATC_prefix = C01
| ATC_suffix = AX02
| PubChem = 14449
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =  
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16498835
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1075790

<!--Chemical data-->
| C=30 | H=44 | O=9 
| smiles = O=C\1OC/C(=C/1)[C@H]6CC[C@@]5(O)[C@]6(C)CC[C@H]3[C@H]5CC[C@@H]4C[C@@H](O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]2O)CC[C@]34C=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C30H44O9/c1-16-24(33)26(36-3)25(34)27(38-16)39-19-6-10-29(15-31)18(13-19)4-5-22-21(29)7-9-28(2)20(8-11-30(22,28)35)17-12-23(32)37-14-17/h12,15-16,18-22,24-27,33-35H,4-11,13-14H2,1-3H3/t16-,18+,19-,20+,21-,22+,24-,25-,26+,27-,28+,29+,30-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PMTSPAGBAFCORP-HBUONDEYSA-N
| synonyms = <small>(3S,5R,10R,13R,14S,17R)- 3-[(2S,5R)- 3,5-dihydroxy- 4-methoxy- 6-methyloxan- 2-yl]oxy- 14-hydroxy- 13-methyl- 17-(5-oxo-2H-furan-3-yl)- 1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthrene- 10-carbaldehyde</small>

'''Peruvoside''' (or '''cannogenin thevetoside''') is a [[Biology:Cardiac glycoside|cardiac glycoside]]<ref>{{ cite book | title = Peruvoside and Other Cardiotonic Glycoside[s] of Thevetia neriifolia Juss: Chemical, Pharmacological, and Clinical Studies | vauthors = Arora RB, Rangaswami S | year = 1972 | publisher = Thomson | location = New Delhi, India | lccn = 78900408}}</ref> for [[Medicine:Heart failure|heart failure]].<ref name="pmid4919553">{{cite journal | vauthors = Bhatia ML, Manchanda SC, Roy SB | title = Haemodynamic studies with peruvoside in human congestive heart failure | journal = British Medical Journal | volume = 3 | issue = 5725 | pages = 740–3 | date = September 1970 | pmid = 4919553 | pmc = 1701679 | doi = 10.1136/bmj.3.5725.740 }}</ref>

It is derived from ''[[Biology:Cascabela thevetia|Cascabela thevetia]]'' (''Thevetia neriifolia'').<ref name="pmid4919553" />

== References ==
{{reflist}}

{{Cardiac glycosides}}

[[Category:Alcohols]]
[[Category:Aldehydes]]


{{Sourceattribution|Peruvoside}}