Chemistry:Peruvoside

From HandWiki
Short description: Chemical compound

{{Drugbox | Verifiedfields = changed | verifiedrevid = 464199541 | IUPAC_name = (3β,5β,8ξ,9ξ)- 3-[(6-deoxy- 3-O-methyl- α-D- glycero- hexopyranosyl)oxy]- 14-hydroxy- 19-oxocard- 20(22)enolide | image = Peruvoside.svg

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ☒N | CAS_number = 1182-87-2 | UNII_Ref =  checkY | UNII = CT36KGC6A6 | ATC_prefix = C01 | ATC_suffix = AX02 | PubChem = 14449 | DrugBank_Ref =  checkY | DrugBank = | ChemSpiderID_Ref =  checkY | ChemSpiderID = 16498835 | ChEMBL_Ref =  checkY | ChEMBL = 1075790

| C=30 | H=44 | O=9 | smiles = O=C\1OC/C(=C/1)[C@H]6CC[C@@]5(O)[C@]6(C)CC[C@H]3[C@H]5CC[C@@H]4C[C@@H](O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]2O)CC[C@]34C=O | StdInChI_Ref =  checkY | StdInChI = 1S/C30H44O9/c1-16-24(33)26(36-3)25(34)27(38-16)39-19-6-10-29(15-31)18(13-19)4-5-22-21(29)7-9-28(2)20(8-11-30(22,28)35)17-12-23(32)37-14-17/h12,15-16,18-22,24-27,33-35H,4-11,13-14H2,1-3H3/t16-,18+,19-,20+,21-,22+,24-,25-,26+,27-,28+,29+,30-/m0/s1 | StdInChIKey_Ref =  checkY | StdInChIKey = PMTSPAGBAFCORP-HBUONDEYSA-N | synonyms = (3S,5R,10R,13R,14S,17R)- 3-[(2S,5R)- 3,5-dihydroxy- 4-methoxy- 6-methyloxan- 2-yl]oxy- 14-hydroxy- 13-methyl- 17-(5-oxo-2H-furan-3-yl)- 1,2,3,4,5,6,7,8,9,11,12,15,16,17- tetradecahydrocyclopenta[a]phenanthrene- 10-carbaldehyde

Peruvoside (or cannogenin thevetoside) is a cardiac glycoside[1] for heart failure.[2]

It is derived from Cascabela thevetia (Thevetia neriifolia).[2]

References

  1. Peruvoside and Other Cardiotonic Glycoside[s] of Thevetia neriifolia Juss: Chemical, Pharmacological, and Clinical Studies. New Delhi, India: Thomson. 1972. 
  2. 2.0 2.1 "Haemodynamic studies with peruvoside in human congestive heart failure". British Medical Journal 3 (5725): 740–3. September 1970. doi:10.1136/bmj.3.5725.740. PMID 4919553.