Chemistry:Dibromoiodoethylene

Dibromoiodoethylene

(Z)-1,2- isomer (E)-1,2- isomer
1,1- isomer
Identifiers
3D model (JSmol)	(Z)-1,2-: Interactive image (E)-1,2-: Interactive image 1,1-: Interactive image
PubChem CID	(Z)-1,2-: 21559773 (E)-1,2-: 102247496 1,1-: 20473688
InChI (Z)-1,2-: InChI=1S/C2HBr2I/c3-1-2(4)5/h1H/b2-1- Key: LKNUFXGEOPARSR-UPHRSURJSA-N (E)-1,2-: InChI=1S/C2HBr2I/c3-1-2(4)5/h1H/b2-1+ Key: LKNUFXGEOPARSR-OWOJBTEDSA-N 1,1-: InChI=1S/C2HBr2I/c3-2(4)1-5/h1H Key: XQBJKLVQMOQFEB-UHFFFAOYSA-N
SMILES (Z)-1,2-: C(=C(/Br)\I)\Br (E)-1,2-: C(=C(\Br)/I)\Br 1,1-: C(=C(Br)Br)I
Properties
Chemical formula	C2HBr2I
Molar mass	311.742 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Tracking categories (test):

• SizeSet

Dibromoiodoethylene is a dense organic liquid consisting of an ethylene core with two bromine atoms and one iodine atom as substituents. It is formed by the reaction of dibromoacetylene with hydrogen iodide.

There are three isomers of dibromoiodoethylene, varying in the position of the two bromine atoms compared to each other.