Chemistry:Iodobenzamide

Iodobenzamide

Names
Preferred IUPAC name N-{[(2S)-1-Ethylpyrrolidin-2-yl]methyl}-2-hydroxy-3-iodo-6-methoxybenzamide
Other names IBZM; Iolopride
Identifiers
CAS Number	84226-06-2 Y 113716-48-6 (123I) Y 113452-80-5 (125I) Y
3D model (JSmol)	Interactive image
ChemSpider	97107
PubChem CID	107995
UNII	9J5D4ZN1JK Y 5E76SOQ99K (123I) Y 0709QG1NOY (125I) Y
InChI InChI=1S/C15H21IN2O3/c1-3-18-8-4-5-10(18)9-17-15(20)13-12(21-2)7-6-11(16)14(13)19/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,17,20)/t10-/m0/s1 Key: CANPFCFJURGKAX-JTQLQIEISA-N InChI=1/C15H21IN2O3/c1-3-18-8-4-5-10(18)9-17-15(20)13-12(21-2)7-6-11(16)14(13)19/h6-7,10,19H,3-5,8-9H2,1-2H3,(H,17,20)/t10-/m0/s1 Key: CANPFCFJURGKAX-JTQLQIEIBE
SMILES Ic1ccc(OC)c(c1O)C(=O)NC[C@H]2N(CC)CCC2
Properties
Chemical formula	C15H21IN2O3
Molar mass	404.248 g·mol−1
Pharmacology
1=ATC code }}	V09AB02 (WHO)
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references

Iodobenzamide (IBZM or iolopride) is a pharmaceutical drug used for diagnostic purposes. It is a dopamine antagonist and it can be used by nuclear medicine physicians as a radioactive tracer for SPECT where the radioactive isotope is iodine-123 or iodine-125. The main purpose of a brain study with IBZM is the differentiation of Parkinson's disease from other neurodegenerative diseases such as Lewy Body dementia and multiple system atrophy.