Oxapium iodide
|
| Names
|
| IUPAC name
1-[(2-cyclohexyl-2-phenyl-1,3-dioxolan-4-yl)methyl]-1-methylpiperidin-1-ium iodide
|
| Other names
Cyclonium, ciclonium
|
| Identifiers
|
|
|
|
|
|
|
| ChEMBL
|
|
| ChemSpider
|
|
| KEGG
|
|
|
|
|
| UNII
|
|
InChI=1S/C22H34NO2.HI/c1-23(15-9-4-10-16-23)17-21-18-24-22(25-21,19-11-5-2-6-12-19)20-13-7-3-8-14-20;/h2,5-6,11-12,20-21H,3-4,7-10,13-18H2,1H3;1H/q+1;/p-1 NKey: YHEWVHONOOWLMW-UHFFFAOYSA-M NInChI=1/C22H34NO2.HI/c1-23(15-9-4-10-16-23)17-21-18-24-22(25-21,19-11-5-2-6-12-19)20-13-7-3-8-14-20;/h2,5-6,11-12,20-21H,3-4,7-10,13-18H2,1H3;1H/q+1;/p-1 Key: YHEWVHONOOWLMW-REWHXWOFAE
|
C[N+]1(CCCCC1)CC2COC(O2)(C3CCCCC3)C4=CC=CC=C4.[I-]
|
| Properties
|
|
|
C22H34INO2
|
| Molar mass
|
471.42 g/mol
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
N verify (what is Y N ?)
|
| Infobox references
|
|
|
|
Tracking categories (test):
Oxapium iodide (ciclonium or cyclonium, trade name Oxaperan) is an antispasmodic indicated for the treatment of gastritis, gastroduodenal ulcer, enteritis, and other conditions. It is marketed in South Korea by Dongsung Pharmaceuticals.
External links
|
|---|
| mAChRs | | Agonists | |
|---|
| Antagonists |
- 3-Quinuclidinyl benzilate
- 4-DAMP
- Aclidinium bromide (+formoterol)
- Abediterol
- AF-DX 250
- AF-DX 384
- Ambutonium bromide
- Anisodamine
- Anisodine
- Antihistamines (first-generation) (e.g., brompheniramine, buclizine, captodiame, chlorphenamine (chlorpheniramine), cinnarizine, clemastine, cyproheptadine, dimenhydrinate, [[Chemistry:Dimetdimetindene, Diphenhydramine|diphenhydramine]], doxylamine, meclizine, mepyramine (pyrilamine), mequitazine, perlapine, phenindamine, pheniramine, Phenyltoloxamine|Phenyltoloxamine]]]], promethazine, propiomazine, triprolidine)
- AQ-RA 741
- Atropine
- Atropine methonitrate
- Atypical antipsychotics (e.g., clozapine, Chemistry:Fluperlapine
|
|---|
|
|---|
Precursors (and prodrugs) | |
|---|
|
 | Original source: https://en.wikipedia.org/wiki/Oxapium iodide. Read more |