Chemistry:5-Ethoxy-DMT
{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 458142861 | IUPAC_name = 2-(5-Ethoxy-1H-indol-3-yl)-N,N-dimethylethanamine | image = 5-EtO-DMT Structure.svg | tradename =
| CAS_number_Ref = 
| CAS_number = 855245-09-9
| PubChem = 57468316
| UNII = RXJ4TM3EX4
| IUPHAR_ligand =
| ChemSpiderID_Ref = 
| ChemSpiderID = 26286732
| StdInChI_Ref =
| StdInChI = 1S/C14H20N2O/c1-4-17-12-5-6-14-13(9-12)11(10-15-14)7-8-16(2)3/h5-6,9-10,15H,4,7-8H2,1-3H3
| StdInChIKey_Ref =
| StdInChIKey = OSUDCFCSUHGWJF-UHFFFAOYSA-N
| C=14 | H=20 | N=2 | O=1 | smiles = CCOc(cc12)ccc1[nH]cc2CCN(C)C
5-Ethoxy-DMT (5-ethoxy-N,N-dimethyltryptamine, 5-EtO-DMT, O-ethylbufotenine) is a tryptamine derivative which has been previously synthesized as a chemical intermediate, but has not been studied to determine its pharmacology.[1][unreliable source?]
The widespread recreational use of N,N-dialkylated 5-methoxytryptamine derivatives including 5-MeO-DMT, 5-MeO-MiPT and 5-MeO-DiPT has led to concern that the 5-ethoxy homologs of these drugs could emerge as novel designer drugs, and consequently 5-EtO-DMT and other derivatives including 5-EtO-DET, 5-EtO-DPT, 5-EtO-DiPT, 5-EtO-DALT, 5-EtO-MPT, 5-EtO-MiPT, 5-EtO-EiPT, 5-EtO-MET and 5-EtO-EPT have been synthesized as analytical standards in order to facilitate future research into these compounds.[2]
See also
References
- ↑ TIHKAL #19
- ↑ "Microwave-accelerated preparation and analytical characterization of 5-ethoxy-N,N-dialkyl-[α,α,β,β-H(4) ]- and [α,α,β,β-D(4) ]-tryptamines". Drug Testing and Analysis 3 (9): 597–608. September 2011. doi:10.1002/dta.223. PMID 21960544.
 |  |
