Chemistry:(R)-3-Nitrobiphenyline

From HandWiki
Revision as of 02:38, 16 March 2024 by Scavis2 (talk | contribs) (linkage)
(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Short description: Drug


{{Drugbox | verifiedrevid = 456494074 | IUPAC_name = (R)-2-[1-(3'-Nitrobiphenyl-2-yloxy)ethyl]-4,5-dihydro-1H-imidazole | image = (R)-3-Nitrobiphenyline.svg | width = 170 | drug_name = (R)-3-Nitrobiphenyline

| tradename = | MedlinePlus = a682611 | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  ☑Y | CAS_number = 945618-95-1 | ATC_prefix = | ATC_suffix = | ChEMBL_Ref =  ☑Y | ChEMBL = 242693 | PubChem = 16757089 | ChemSpiderID_Ref =  ☑Y | ChemSpiderID = 23288036

| C=17 | H=17 | N=3 | O=3 | smiles = c2ccc([N](=O)=O)cc2-c1ccccc1OC(C)C3=NCCN3 | StdInChI_Ref =  ☑Y | StdInChI = 1S/C17H17N3O3/c1-12(17-18-9-10-19-17)23-16-8-3-2-7-15(16)13-5-4-6-14(11-13)20(21)22/h2-8,11-12H,9-10H2,1H3,(H,18,19)/t12-/m1/s1 | StdInChIKey_Ref =  ☑Y | StdInChIKey = NMSAVNXFCXMJJY-GFCCVEGCSA-N | melting_point = | melting_high =

(R)-3-Nitrobiphenyline is a drug which acts as an α2-adrenergic agonist, selective for the α2C subtype, as well as being a weak antagonist at the α2A and α2B subtypes. It has been used in scientific research to characterize the binding and functional properties of the α2C subtype.[1][2]

References

  1. "Alpha2-adrenoreceptors profile modulation. 3.1 (R)-(+)-m-nitrobiphenyline, a new efficient and alpha2C-subtype selective agonist". Journal of Medicinal Chemistry 50 (16): 3964–3968. August 2007. doi:10.1021/jm061487a. PMID 17630725. 
  2. "Fruitful adrenergic α(2C)-agonism/α(2A)-antagonism combination to prevent and contrast morphine tolerance and dependence". Journal of Medicinal Chemistry 53 (21): 7825–7835. November 2010. doi:10.1021/jm100977d. PMID 20925410.