(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
Short description: Chemical compound
Hexethal |
| Clinical data |
|---|
| Other names | Sodium 5-ethyl-5-hexylbarbiturate, Ortal, Hebaral |
|---|
| ATC code | |
|---|
| Legal status |
|---|
| Legal status |
|
|---|
| Identifiers |
|---|
sodium 5-ethyl-5-hexyl-4,6-dioxo-1H-pyrimidin-2-olate
|
| CAS Number | |
|---|
| PubChem CID | |
|---|
| ChemSpider | |
|---|
| UNII | |
|---|
| Chemical and physical data |
|---|
| Formula | C12H19N2NaO3 |
|---|
| Molar mass | 262.285 g·mol−1 |
|---|
| 3D model (JSmol) | |
|---|
[Na+].O=C1/N=C(/[O-])NC(=O)C1(CCCCCC)CC
|
InChI=1S/C12H20N2O3.Na/c1-3-5-6-7-8-12(4-2)9(15)13-11(17)14-10(12)16;/h3-8H2,1-2H3,(H2,13,14,15,16,17);/q;+1/p-1  YKey:HXUAXLUDTCGASZ-UHFFFAOYSA-M Y
|
| (verify) |
Hexethal (Ortal) is a barbiturate derivative invented in the 1940s. It has sedative, anxiolytic, muscle relaxant, and anticonvulsant properties, and was used primarily as an anaesthetic in veterinary medicine.
[1]
Hexethal is considered similar in effects to pentobarbital, with a very fast onset of action but short duration of effects.
References
- ↑ "The rate of penetration of barbituric acid derivatives into the brain". The Journal of Pharmacology and Experimental Therapeutics 100 (2): 219–26. October 1950. PMID 14784958.
|
|---|
| Alcohols | |
|---|
| Barbiturates | |
|---|
| Benzodiazepines | |
|---|
| Carbamates | |
|---|
| Flavonoids | |
|---|
| Imidazoles | |
|---|
| Kava constituents | |
|---|
| Monoureides | |
|---|
| Neuroactive steroids | |
|---|
| Nonbenzodiazepines | |
|---|
| Phenols | |
|---|
| Piperidinediones | |
|---|
| Pyrazolopyridines | |
|---|
| Quinazolinones | |
|---|
| Volatiles/gases | |
|---|
| Others/unsorted |
- 3-Hydroxybutanal
- α-EMTBL
- AA-29504
- Avermectins (e.g., ivermectin)
- Bromide compounds (e.g., lithium bromide, potassium bromide, sodium bromide)
- Carbamazepine
- Chloralose
- Chlormezanone
- Clomethiazole
- DEABL
- Dihydroergolines (e.g., dihydroergocryptine, dihydroergosine, dihydroergotamine, ergoloid (dihydroergotoxine))
- DS2
- Efavirenz
- Etazepine
- Etifoxine
- Fenamates (e.g., flufenamic acid, mefenamic acid, niflumic acid, tolfenamic acid)
- Fluoxetine
- Flupirtine
- Hopantenic acid
- Lanthanum
- Lavender oil
- Lignans (e.g., 4-O-methylhonokiol, honokiol, magnolol, obovatol)
- Loreclezole
- Menthyl isovalerate (validolum)
- Monastrol
- Niacin
- Nicotinamide (niacinamide)
- Org 25,435
- Phenytoin
- Propanidid
- Retigabine (ezogabine)
- Safranal
- Seproxetine
- Stiripentol
- Sulfonylalkanes (e.g., sulfonmethane (sulfonal), tetronal, trional)
- Terpenoids (e.g., borneol)
- Topiramate
- Valerian constituents (e.g., isovaleric acid, isovaleramide, valerenic acid, valerenol)
|
|---|
|
 | Original source: https://en.wikipedia.org/wiki/Hexethal. Read more |
