(diff) ← Older revision | Latest revision (diff) | Newer revision → (diff)
WIN-2299
|
| Names
|
Preferred IUPAC name
2-(Diethylamino)ethyl cyclopentyl(hydroxy)(thiophen-2-yl)acetate |
| Identifiers
|
|
|
|
|
|
|
| ChemSpider
|
|
| EC Number
|
|
|
|
|
InChI=1S/C17H27NO3S/c1-3-18(4-2)11-12-21-16(19)17(20,14-8-5-6-9-14)15-10-7-13-22-15/h7,10,13-14,20H,3-6,8-9,11-12H2,1-2H3 Key: ASXBIKGZCPZCAN-UHFFFAOYSA-N InChI=1/C17H27NO3S/c1-3-18(4-2)11-12-21-16(19)17(20,14-8-5-6-9-14)15-10-7-13-22-15/h7,10,13-14,20H,3-6,8-9,11-12H2,1-2H3 Key: ASXBIKGZCPZCAN-UHFFFAOYAH
|
O=C(OCCN(CC)CC)C(O)(C1CCCC1)C2=CC=CS2
|
| Properties
|
|
|
C17H27NO3S
|
| Molar mass
|
325.47 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references
|
|
|
|
WIN-2299 is an anticholinergic drug.[1] Human reactions to WIN-2299 include sedation (2 mg), LSD-like reactions (6 mg), and an acute delirious episode (10 mg).[2]
References
- ↑ Luduena, FP; Lands, AM (1954). "An investigation of the pharmacological actions of three potent antispasmodic compounds and their corresponding metho-salts". The Journal of Pharmacology and Experimental Therapeutics 110 (3): 282–92. PMID 13143475.
- ↑ Pennes, HH; Hoch, PH (1957). "Psychotomimetics, clinical and theoretical considerations: Harmine, Win-2299 and nalline". The American Journal of Psychiatry 113 (10): 887–92. doi:10.1176/ajp.113.10.887. PMID 13402982.
|
|---|
Psychedelics
(5-HT2A
agonists) | | Benzofurans | |
|---|
Lyserg‐
amides | |
|---|
Phenethyl‐
amines | | 2C-x | | 25x-NBx | | 25x-NB3OMe | |
|---|
| 25x-NB4OMe | |
|---|
| 25x-NBF | |
|---|
| 25x-NBMD | |
|---|
| 25x-NBOH | |
|---|
| 25x-NBOMe | |
|---|
| Atypical structures | |
|---|
|
|---|
|
|---|
| 3C-x | |
|---|
| 4C-x | |
|---|
| DOx | |
|---|
| HOT-x | |
|---|
| MDxx | |
|---|
| Mescaline (subst.) | |
|---|
| TMAs |
- TMA
- TMA-2
- TMA-3
- TMA-4
- TMA-5
- TMA-6
|
|---|
| Others | |
|---|
|
|---|
| Piperazines | |
|---|
| Tryptamines | | alpha-alkyltryptamines | |
|---|
| x-DALT | |
|---|
| x-DET | |
|---|
| x-DiPT | |
|---|
| x-DMT |
- 4,5-DHP-DMT
- 2,N,N-TMT
- 4-AcO-DMT
- 4-HO-5-MeO-DMT
- 4,N,N-TMT
- 4-Propionyloxy-DMT
- 5,6-diBr-DMT
- 5-AcO-DMT
- 5-Bromo-DMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 5-MeO-α,N,N-TMT
- 5-MeO-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- α,N,N-TMT
- (Bufotenin) 5-HO-DMT
- DMT
- Norbaeocystin
- (Psilocin) 4-HO-DMT
- (Psilocybin) 4-PO-DMT
|
|---|
| x-DPT | |
|---|
| Ibogaine-related | |
|---|
| x-MET | |
|---|
| x-MiPT | |
|---|
| Others | |
|---|
|
|---|
| Others | |
|---|
|
|---|
Dissociatives
(NMDAR
antagonists) | |
|---|
Deliriants
(mAChR
antagonists) | |
|---|
| Others | |
|---|
|
|---|
| mAChRs | | Agonists | |
|---|
| Antagonists |
- 3-Quinuclidinyl benzilate
- 4-DAMP
- Aclidinium bromide (+formoterol)
- Abediterol
- AF-DX 250
- AF-DX 384
- Ambutonium bromide
- Anisodamine
- Anisodine
- Antihistamines (first-generation) (e.g., brompheniramine, buclizine, captodiame, chlorphenamine (chlorpheniramine), cinnarizine, clemastine, cyproheptadine, dimenhydrinate, [[Chemistry:Dimetdimetindene, Diphenhydramine|diphenhydramine]], doxylamine, meclizine, mepyramine (pyrilamine), mequitazine, perlapine, phenindamine, pheniramine, Phenyltoloxamine|Phenyltoloxamine]]]], promethazine, propiomazine, triprolidine)
- AQ-RA 741
- Atropine
- Atropine methonitrate
- Atypical antipsychotics (e.g., clozapine, Chemistry:Fluperlapine
|
|---|
|
|---|
Precursors
(and prodrugs) | |
|---|
|
 | Original source: https://en.wikipedia.org/wiki/WIN-2299. Read more |
